ChemNet > CAS > 21815-91-8 3-Chlorobenzo[b]-2-thiophenecarboxylic acid chloride
21815-91-8 3-Chlorobenzo[b]-2-thiophenecarboxylic acid chloride
Naam product |
3-Chlorobenzo[b]-2-thiophenecarboxylic acid chloride |
Engelse naam |
3-Chlorobenzo[b]-2-thiophenecarboxylic acid chloride; 3-Chlorobenzo[b]thiophene-2-carbonyl chloride; AKOS B000002; AKOS AU36-M326; AKOS 92491; 3-CHLOROBENZOTHIOPHENE-2-CARBONYL CHLORIDE; BUTTPARK 30\06-08; ASISCHEM T31091; ART-CHEM-BB B000002; 3-chloro-1-benzothiophene-2-carbonyl chloride |
MF |
C9H4Cl2OS |
Molecuulgewicht |
231.0985 |
InChI |
InChI=1/C9H4Cl2OS/c10-7-5-3-1-2-4-6(5)13-8(7)9(11)12/h1-4H |
CAS-nummer |
21815-91-8 |
Moleculaire Structuur |
|
Dichtheid |
1.526g/cm3 |
Smeltpunt |
114℃ |
Kookpunt |
342.2°C at 760 mmHg |
Brekingsindex |
1.686 |
Vlampunt |
160.7°C |
Dampdruk |
7.67E-05mmHg at 25°C |
Gevaarsymbolen |
C:Corrosive;
|
Risico-codes |
R34:Causes burns.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|